C25H36OS2Sn — CID 142513471
tributyl-[2-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]stannane (PubChem CID 142513471) has the molecular formula C25H36OS2Sn and a molecular weight of 535.41 g/mol. Its IUPAC name is tributyl-[2-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]stannane.
| Compound Name | tributyl-[2-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]stannane |
|---|---|
| PubChem CID | 142513471 |
| Molecular Formula | C25H36OS2Sn |
| Molecular Weight | 535.41 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | tributyl-[2-(4-methoxyphenyl)thieno[3,2-b]thiophen-5-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc2sc(-c3ccc(OC)cc3)cc2s1 |
| InChI | InChI=1S/C13H9OS2.3C4H9.Sn/c1-14-10-4-2-9(3-5-10)12-8-13-11(16-12)6-7-15-13;3*1-3-4-2;/h2-6,8H,1H3;3*1,3-4H2,2H3; |
| InChIKey | PHHNNGYWYTYRPB-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.41 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |