C30H43NO2SSn — CID 156653524
N,N-bis(4-methoxyphenyl)-5-tributylstannylthiophen-2-amine (PubChem CID 156653524) has the molecular formula C30H43NO2SSn and a molecular weight of 600.46 g/mol. Its IUPAC name is N,N-bis(4-methoxyphenyl)-5-tributylstannylthiophen-2-amine.
| Compound Name | N,N-bis(4-methoxyphenyl)-5-tributylstannylthiophen-2-amine |
|---|---|
| PubChem CID | 156653524 |
| Molecular Formula | C30H43NO2SSn |
| Molecular Weight | 600.46 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N,N-bis(4-methoxyphenyl)-5-tributylstannylthiophen-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(N(c2ccc(OC)cc2)c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C18H16NO2S.3C4H9.Sn/c1-20-16-9-5-14(6-10-16)19(18-4-3-13-22-18)15-7-11-17(21-2)12-8-15;3*1-3-4-2;/h3-12H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | NDAJNTDQMMRXFF-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.46 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |