C13H13BrClNS — CID 102827153
1-(4-bromo-5-methylthiophen-2-yl)-2-(2-chlorophenyl)ethanamine (PubChem CID 102827153) has the molecular formula C13H13BrClNS and a molecular weight of 330.68 g/mol. Its IUPAC name is 1-(4-bromo-5-methylthiophen-2-yl)-2-(2-chlorophenyl)ethanamine.
| Compound Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-(2-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 102827153 |
| Molecular Formula | C13H13BrClNS |
| Molecular Weight | 330.68 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 1-(4-bromo-5-methylthiophen-2-yl)-2-(2-chlorophenyl)ethanamine |
| SMILES | Cc1sc(C(N)Cc2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C13H13BrClNS/c1-8-10(14)7-13(17-8)12(16)6-9-4-2-3-5-11(9)15/h2-5,7,12H,6,16H2,1H3 |
| InChIKey | IWXNTDFEKRFIQO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |