C18H22ClN — CID 43103860
2-(2-chlorophenyl)-1-(2,3,5,6-tetramethylphenyl)ethanamine (PubChem CID 43103860) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(2,3,5,6-tetramethylphenyl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)-1-(2,3,5,6-tetramethylphenyl)ethanamine |
|---|---|
| PubChem CID | 43103860 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(2,3,5,6-tetramethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C)c(C(N)Cc2ccccc2Cl)c1C |
| InChI | InChI=1S/C18H22ClN/c1-11-9-12(2)14(4)18(13(11)3)17(20)10-15-7-5-6-8-16(15)19/h5-9,17H,10,20H2,1-4H3 |
| InChIKey | ANUSMNOKOQOGAA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |