C15H13BrS2 — CID 80739568
5-[1-bromo-2-(4-methylphenyl)ethyl]thieno[3,2-b]thiophene (PubChem CID 80739568) has the molecular formula C15H13BrS2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 5-[1-bromo-2-(4-methylphenyl)ethyl]thieno[3,2-b]thiophene.
| Compound Name | 5-[1-bromo-2-(4-methylphenyl)ethyl]thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 80739568 |
| Molecular Formula | C15H13BrS2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 5-[1-bromo-2-(4-methylphenyl)ethyl]thieno[3,2-b]thiophene |
| SMILES | Cc1ccc(CC(Br)c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C15H13BrS2/c1-10-2-4-11(5-3-10)8-12(16)14-9-15-13(18-14)6-7-17-15/h2-7,9,12H,8H2,1H3 |
| InChIKey | MZSPDTMHOVEJGL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|