C17H17NOS — CID 81143867
(4-propylphenyl)-thieno[3,2-b]pyridin-6-ylmethanol (PubChem CID 81143867) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is (4-propylphenyl)-thieno[3,2-b]pyridin-6-ylmethanol.
| Compound Name | (4-propylphenyl)-thieno[3,2-b]pyridin-6-ylmethanol |
|---|---|
| PubChem CID | 81143867 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (4-propylphenyl)-thieno[3,2-b]pyridin-6-ylmethanol |
| SMILES | CCCc1ccc(C(O)c2cnc3ccsc3c2)cc1 |
| InChI | InChI=1S/C17H17NOS/c1-2-3-12-4-6-13(7-5-12)17(19)14-10-16-15(18-11-14)8-9-20-16/h4-11,17,19H,2-3H2,1H3 |
| InChIKey | GLCPMXMKJGVBLT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |