C15H10F3NOS — CID 81154217
thieno[3,2-b]pyridin-6-yl-[4-(trifluoromethyl)phenyl]methanol (PubChem CID 81154217) has the molecular formula C15H10F3NOS and a molecular weight of 309.31 g/mol. Its IUPAC name is thieno[3,2-b]pyridin-6-yl-[4-(trifluoromethyl)phenyl]methanol.
| Compound Name | thieno[3,2-b]pyridin-6-yl-[4-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 81154217 |
| Molecular Formula | C15H10F3NOS |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | thieno[3,2-b]pyridin-6-yl-[4-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1ccc(C(F)(F)F)cc1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H10F3NOS/c16-15(17,18)11-3-1-9(2-4-11)14(20)10-7-13-12(19-8-10)5-6-21-13/h1-8,14,20H |
| InChIKey | RKLOPINVLZPGNK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |