C16H10FNO2S — CID 114727100
(7-fluoro-1-benzofuran-2-yl)-thieno[3,2-b]pyridin-6-ylmethanol (PubChem CID 114727100) has the molecular formula C16H10FNO2S and a molecular weight of 299.33 g/mol. Its IUPAC name is (7-fluoro-1-benzofuran-2-yl)-thieno[3,2-b]pyridin-6-ylmethanol.
| Compound Name | (7-fluoro-1-benzofuran-2-yl)-thieno[3,2-b]pyridin-6-ylmethanol |
|---|---|
| PubChem CID | 114727100 |
| Molecular Formula | C16H10FNO2S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (7-fluoro-1-benzofuran-2-yl)-thieno[3,2-b]pyridin-6-ylmethanol |
| SMILES | OC(c1cnc2ccsc2c1)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C16H10FNO2S/c17-11-3-1-2-9-6-13(20-16(9)11)15(19)10-7-14-12(18-8-10)4-5-21-14/h1-8,15,19H |
| InChIKey | OVSHQIYPJOGKCD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |