C15H12Cl2N2S — CID 65467399
2,6-dichloro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline (PubChem CID 65467399) has the molecular formula C15H12Cl2N2S and a molecular weight of 323.25 g/mol. Its IUPAC name is 2,6-dichloro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline.
| Compound Name | 2,6-dichloro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
|---|---|
| PubChem CID | 65467399 |
| Molecular Formula | C15H12Cl2N2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2,6-dichloro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
| SMILES | CC(Nc1c(Cl)cccc1Cl)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H12Cl2N2S/c1-9(19-15-11(16)3-2-4-12(15)17)10-7-14-13(18-8-10)5-6-20-14/h2-9,19H,1H3 |
| InChIKey | AKRSNSYPSMTOHC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |