C15H12Br2N2S — CID 64830748
2,5-dibromo-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline (PubChem CID 64830748) has the molecular formula C15H12Br2N2S and a molecular weight of 412.15 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline.
| Compound Name | 2,5-dibromo-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
|---|---|
| PubChem CID | 64830748 |
| Molecular Formula | C15H12Br2N2S |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 2,5-dibromo-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
| SMILES | CC(Nc1cc(Br)ccc1Br)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H12Br2N2S/c1-9(19-14-7-11(16)2-3-12(14)17)10-6-15-13(18-8-10)4-5-20-15/h2-9,19H,1H3 |
| InChIKey | VQSGDZVLPOLYEF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |