C16H12ClN3S — CID 107807233
3-chloro-4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzonitrile (PubChem CID 107807233) has the molecular formula C16H12ClN3S and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-chloro-4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzonitrile.
| Compound Name | 3-chloro-4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzonitrile |
|---|---|
| PubChem CID | 107807233 |
| Molecular Formula | C16H12ClN3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3-chloro-4-(1-thieno[3,2-b]pyridin-6-ylethylamino)benzonitrile |
| SMILES | CC(Nc1ccc(C#N)cc1Cl)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C16H12ClN3S/c1-10(12-7-16-15(19-9-12)4-5-21-16)20-14-3-2-11(8-18)6-13(14)17/h2-7,9-10,20H,1H3 |
| InChIKey | FCTAYOAYZVFCJR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |