C15H11Cl3N2 — CID 107807205
3-chloro-4-[1-(3,4-dichlorophenyl)ethylamino]benzonitrile (PubChem CID 107807205) has the molecular formula C15H11Cl3N2 and a molecular weight of 325.63 g/mol. Its IUPAC name is 3-chloro-4-[1-(3,4-dichlorophenyl)ethylamino]benzonitrile.
| Compound Name | 3-chloro-4-[1-(3,4-dichlorophenyl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 107807205 |
| Molecular Formula | C15H11Cl3N2 |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3-chloro-4-[1-(3,4-dichlorophenyl)ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc(C#N)cc1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2/c1-9(11-3-4-12(16)13(17)7-11)20-15-5-2-10(8-19)6-14(15)18/h2-7,9,20H,1H3 |
| InChIKey | UKCXSTXGBGUFNH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |