C16H11Cl2N3 — CID 107788207
4-[1-(3,4-dichlorophenyl)ethylamino]benzene-1,2-dicarbonitrile (PubChem CID 107788207) has the molecular formula C16H11Cl2N3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)ethylamino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[1-(3,4-dichlorophenyl)ethylamino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107788207 |
| Molecular Formula | C16H11Cl2N3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)ethylamino]benzene-1,2-dicarbonitrile |
| SMILES | CC(Nc1ccc(C#N)c(C#N)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2N3/c1-10(11-3-5-15(17)16(18)7-11)21-14-4-2-12(8-19)13(6-14)9-20/h2-7,10,21H,1H3 |
| InChIKey | CSOIRCWSZSMJLC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |