C16H14Cl2N2O — CID 43104190
2-[4-[1-(3,4-dichlorophenyl)ethylamino]phenoxy]acetonitrile (PubChem CID 43104190) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-[4-[1-(3,4-dichlorophenyl)ethylamino]phenoxy]acetonitrile.
| Compound Name | 2-[4-[1-(3,4-dichlorophenyl)ethylamino]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 43104190 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[4-[1-(3,4-dichlorophenyl)ethylamino]phenoxy]acetonitrile |
| SMILES | CC(Nc1ccc(OCC#N)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-11(12-2-7-15(17)16(18)10-12)20-13-3-5-14(6-4-13)21-9-8-19/h2-7,10-11,20H,9H2,1H3 |
| InChIKey | LHVKYLKVZPAMRB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|