C12H15ClN2O2 — CID 107807565
3-chloro-4-(1,1-dimethoxypropan-2-ylamino)benzonitrile (PubChem CID 107807565) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 3-chloro-4-(1,1-dimethoxypropan-2-ylamino)benzonitrile.
| Compound Name | 3-chloro-4-(1,1-dimethoxypropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 107807565 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-chloro-4-(1,1-dimethoxypropan-2-ylamino)benzonitrile |
| SMILES | COC(OC)C(C)Nc1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O2/c1-8(12(16-2)17-3)15-11-5-4-9(7-14)6-10(11)13/h4-6,8,12,15H,1-3H3 |
| InChIKey | GBVHWBVNRBPFGR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|