C15H13FN2S — CID 64829352
2-fluoro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline (PubChem CID 64829352) has the molecular formula C15H13FN2S and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-fluoro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline.
| Compound Name | 2-fluoro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
|---|---|
| PubChem CID | 64829352 |
| Molecular Formula | C15H13FN2S |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-fluoro-N-(1-thieno[3,2-b]pyridin-6-ylethyl)aniline |
| SMILES | CC(Nc1ccccc1F)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H13FN2S/c1-10(18-13-5-3-2-4-12(13)16)11-8-15-14(17-9-11)6-7-19-15/h2-10,18H,1H3 |
| InChIKey | CVVZNLGMFZXIQS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |