C11H14F3N7 — CID 107066373
2-[1-hydrazinyl-2-(2-methyltetrazol-5-yl)ethyl]-4-(trifluoromethyl)aniline (PubChem CID 107066373) has the molecular formula C11H14F3N7 and a molecular weight of 301.28 g/mol. Its IUPAC name is 2-[1-hydrazinyl-2-(2-methyltetrazol-5-yl)ethyl]-4-(trifluoromethyl)aniline.
| Compound Name | 2-[1-hydrazinyl-2-(2-methyltetrazol-5-yl)ethyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107066373 |
| Molecular Formula | C11H14F3N7 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[1-hydrazinyl-2-(2-methyltetrazol-5-yl)ethyl]-4-(trifluoromethyl)aniline |
| SMILES | Cn1nnc(CC(NN)c2cc(C(F)(F)F)ccc2N)n1 |
| InChI | InChI=1S/C11H14F3N7/c1-21-19-10(18-20-21)5-9(17-16)7-4-6(11(12,13)14)2-3-8(7)15/h2-4,9,17H,5,15-16H2,1H3 |
| InChIKey | NVUYHMFONXPBSC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|