C11H15BrN6O — CID 112742241
[1-(5-bromo-2-methoxyphenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine (PubChem CID 112742241) has the molecular formula C11H15BrN6O and a molecular weight of 327.19 g/mol. Its IUPAC name is [1-(5-bromo-2-methoxyphenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(5-bromo-2-methoxyphenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 112742241 |
| Molecular Formula | C11H15BrN6O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [1-(5-bromo-2-methoxyphenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
| SMILES | COc1ccc(Br)cc1C(Cc1nnn(C)n1)NN |
| InChI | InChI=1S/C11H15BrN6O/c1-18-16-11(15-17-18)6-9(14-13)8-5-7(12)3-4-10(8)19-2/h3-5,9,14H,6,13H2,1-2H3 |
| InChIKey | VFULHDXPUINAOT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|