C12H15N9 — CID 107066810
[2-(2-methyltetrazol-5-yl)-1-(2-phenyltriazol-4-yl)ethyl]hydrazine (PubChem CID 107066810) has the molecular formula C12H15N9 and a molecular weight of 285.32 g/mol. Its IUPAC name is [2-(2-methyltetrazol-5-yl)-1-(2-phenyltriazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyltetrazol-5-yl)-1-(2-phenyltriazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066810 |
| Molecular Formula | C12H15N9 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | [2-(2-methyltetrazol-5-yl)-1-(2-phenyltriazol-4-yl)ethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2cnn(-c3ccccc3)n2)n1 |
| InChI | InChI=1S/C12H15N9/c1-20-18-12(16-19-20)7-10(15-13)11-8-14-21(17-11)9-5-3-2-4-6-9/h2-6,8,10,15H,7,13H2,1H3 |
| InChIKey | DYKBTPDVQGHCLZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|