C10H13N5 — CID 105254603
[2-phenyl-1-(2H-triazol-4-yl)ethyl]hydrazine (PubChem CID 105254603) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is [2-phenyl-1-(2H-triazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-phenyl-1-(2H-triazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105254603 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | [2-phenyl-1-(2H-triazol-4-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccccc1)c1cn[nH]n1 |
| InChI | InChI=1S/C10H13N5/c11-13-9(10-7-12-15-14-10)6-8-4-2-1-3-5-8/h1-5,7,9,13H,6,11H2,(H,12,14,15) |
| InChIKey | YOMRINIIRDCZFW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|