C6H9N5 — CID 105254798
1-(2H-triazol-4-yl)but-3-ynylhydrazine (PubChem CID 105254798) has the molecular formula C6H9N5 and a molecular weight of 151.17 g/mol. Its IUPAC name is 1-(2H-triazol-4-yl)but-3-ynylhydrazine.
| Compound Name | 1-(2H-triazol-4-yl)but-3-ynylhydrazine |
|---|---|
| PubChem CID | 105254798 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 1-(2H-triazol-4-yl)but-3-ynylhydrazine |
| SMILES | C#CCC(NN)c1cn[nH]n1 |
| InChI | InChI=1S/C6H9N5/c1-2-3-5(9-7)6-4-8-11-10-6/h1,4-5,9H,3,7H2,(H,8,10,11) |
| InChIKey | QBFHOFDZBFXDHG-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|