C10H9F3N2 — CID 105281540
1-(2,4,6-trifluorophenyl)but-3-ynylhydrazine (PubChem CID 105281540) has the molecular formula C10H9F3N2 and a molecular weight of 214.19 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)but-3-ynylhydrazine.
| Compound Name | 1-(2,4,6-trifluorophenyl)but-3-ynylhydrazine |
|---|---|
| PubChem CID | 105281540 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)but-3-ynylhydrazine |
| SMILES | C#CCC(NN)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H9F3N2/c1-2-3-9(15-14)10-7(12)4-6(11)5-8(10)13/h1,4-5,9,15H,3,14H2 |
| InChIKey | RLYSIQUYEOHFPP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|