C9H9F3N2 — CID 105318054
1-(2,4,6-trifluorophenyl)prop-2-enylhydrazine (PubChem CID 105318054) has the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)prop-2-enylhydrazine.
| Compound Name | 1-(2,4,6-trifluorophenyl)prop-2-enylhydrazine |
|---|---|
| PubChem CID | 105318054 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)prop-2-enylhydrazine |
| SMILES | C=CC(NN)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H9F3N2/c1-2-8(14-13)9-6(11)3-5(10)4-7(9)12/h2-4,8,14H,1,13H2 |
| InChIKey | MWXDWANQQPJSEF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|