C14H17F3OS — CID 58439457
2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene (PubChem CID 58439457) has the molecular formula C14H17F3OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene.
| Compound Name | 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 58439457 |
| Molecular Formula | C14H17F3OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene |
| SMILES | C=C[C@H](C[S@@](=O)C(C)(C)C)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H17F3OS/c1-5-9(8-19(18)14(2,3)4)13-11(16)6-10(15)7-12(13)17/h5-7,9H,1,8H2,2-4H3/t9-,19-/m1/s1 |
| InChIKey | CVTHYFHOYFHFQE-AYLIAGHASA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|