About 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene
2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene (PubChem CID 58439457) has the molecular formula C14H17F3OS
and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene.
Molecular Properties
| Compound Name | 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene |
| PubChem CID | 58439457 |
| Molecular Formula | C14H17F3OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene |
| SMILES | C=C[C@H](C[S@@](=O)C(C)(C)C)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H17F3OS/c1-5-9(8-19(18)14(2,3)4)13-11(16)6-10(15)7-12(13)17/h5-7,9H,1,8H2,2-4H3/t9-,19-/m1/s1 |
| InChIKey | CVTHYFHOYFHFQE-AYLIAGHASA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene?
The IUPAC name of 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene (CID 58439457) is 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene.
What is the SMILES notation for 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene?
The canonical SMILES for 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene is C=C[C@H](C[S@@](=O)C(C)(C)C)c1c(F)cc(F)cc1F.
What is the InChIKey of 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene?
The InChIKey is CVTHYFHOYFHFQE-AYLIAGHASA-N. The full InChI is InChI=1S/C14H17F3OS/c1-5-9(8-19(18)14(2,3)4)13-11(16)6-10(15)7-12(13)17/h5-7,9H,1,8H2,2-4H3/t9-,19-/m1/s1.
What are the key properties of 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene?
2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene has a molecular weight of 290.35 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1-[(R)-tert-butylsulfinyl]but-3-en-2-yl]-1,3,5-trifluorobenzene is sourced from PubChem (CID 58439457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).