C13H16F2O — CID 175789384
3,5-difluoro-2-hexan-3-ylbenzaldehyde (PubChem CID 175789384) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is 3,5-difluoro-2-hexan-3-ylbenzaldehyde.
| Compound Name | 3,5-difluoro-2-hexan-3-ylbenzaldehyde |
|---|---|
| PubChem CID | 175789384 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3,5-difluoro-2-hexan-3-ylbenzaldehyde |
| SMILES | CCCC(CC)c1c(F)cc(F)cc1C=O |
| InChI | InChI=1S/C13H16F2O/c1-3-5-9(4-2)13-10(8-16)6-11(14)7-12(13)15/h6-9H,3-5H2,1-2H3 |
| InChIKey | XWZJGRQRFJKNTE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|