C12H12F4 — CID 118269607
1-fluoro-3-pent-1-en-3-yl-5-(trifluoromethyl)benzene (PubChem CID 118269607) has the molecular formula C12H12F4 and a molecular weight of 232.22 g/mol. Its IUPAC name is 1-fluoro-3-pent-1-en-3-yl-5-(trifluoromethyl)benzene.
| Compound Name | 1-fluoro-3-pent-1-en-3-yl-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118269607 |
| Molecular Formula | C12H12F4 |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-fluoro-3-pent-1-en-3-yl-5-(trifluoromethyl)benzene |
| SMILES | C=CC(CC)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F4/c1-3-8(4-2)9-5-10(12(14,15)16)7-11(13)6-9/h3,5-8H,1,4H2,2H3 |
| InChIKey | FDDYQHIZJQTHCR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|