C22H25F5 — CID 143471717
acetylene;buta-1,3-diene;1-fluoro-3-[(2R,3E,5E)-6-fluoro-3-methylocta-3,5-dien-2-yl]-5-(trifluoromethyl)benzene (PubChem CID 143471717) has the molecular formula C22H25F5 and a molecular weight of 384.43 g/mol. Its IUPAC name is acetylene;buta-1,3-diene;1-fluoro-3-[(2R,3E,5E)-6-fluoro-3-methylocta-3,5-dien-2-yl]-5-(trifluoromethyl)benzene.
| Compound Name | acetylene;buta-1,3-diene;1-fluoro-3-[(2R,3E,5E)-6-fluoro-3-methylocta-3,5-dien-2-yl]-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143471717 |
| Molecular Formula | C22H25F5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | acetylene;buta-1,3-diene;1-fluoro-3-[(2R,3E,5E)-6-fluoro-3-methylocta-3,5-dien-2-yl]-5-(trifluoromethyl)benzene |
| SMILES | C#C.C=CC=C.CC/C(F)=C\C=C(/C)[C@@H](C)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F5.C4H6.C2H2/c1-4-14(17)6-5-10(2)11(3)12-7-13(16(19,20)21)9-15(18)8-12;1-3-4-2;1-2/h5-9,11H,4H2,1-3H3;3-4H,1-2H2;1-2H/b10-5+,14-6+;;/t11-;;/m1../s1 |
| InChIKey | BPMSQNSKBNAIGU-BRQMYGDDSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|