C23H23F5N2 — CID 143689279
acetylene;2-[(1S,3Z)-3-ethenyl-1-[3-fluoro-5-(trifluoromethyl)phenyl]hexa-3,5-dienyl]-5-fluoropyridine;methanamine (PubChem CID 143689279) has the molecular formula C23H23F5N2 and a molecular weight of 422.44 g/mol. Its IUPAC name is acetylene;2-[(1S,3Z)-3-ethenyl-1-[3-fluoro-5-(trifluoromethyl)phenyl]hexa-3,5-dienyl]-5-fluoropyridine;methanamine.
| Compound Name | acetylene;2-[(1S,3Z)-3-ethenyl-1-[3-fluoro-5-(trifluoromethyl)phenyl]hexa-3,5-dienyl]-5-fluoropyridine;methanamine |
|---|---|
| PubChem CID | 143689279 |
| Molecular Formula | C23H23F5N2 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | acetylene;2-[(1S,3Z)-3-ethenyl-1-[3-fluoro-5-(trifluoromethyl)phenyl]hexa-3,5-dienyl]-5-fluoropyridine;methanamine |
| SMILES | C#C.C=C/C=C(\C=C)C[C@@H](c1cc(F)cc(C(F)(F)F)c1)c1ccc(F)cn1.CN |
| InChI | InChI=1S/C20H16F5N.C2H2.CH5N/c1-3-5-13(4-2)8-18(19-7-6-16(21)12-26-19)14-9-15(20(23,24)25)11-17(22)10-14;2*1-2/h3-7,9-12,18H,1-2,8H2;1-2H;2H2,1H3/b13-5+;;/t18-;;/m0../s1 |
| InChIKey | MXCXTLRHOKONAL-CUQAIUBGSA-N |
| XLogP | 6.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|