C15H21BrFNOS — CID 126545840
(1S)-1-(3-bromo-5-fluorophenyl)-N-(tert-butylsulfinylmethyl)but-3-en-1-amine (PubChem CID 126545840) has the molecular formula C15H21BrFNOS and a molecular weight of 362.31 g/mol. Its IUPAC name is (1S)-1-(3-bromo-5-fluorophenyl)-N-(tert-butylsulfinylmethyl)but-3-en-1-amine.
| Compound Name | (1S)-1-(3-bromo-5-fluorophenyl)-N-(tert-butylsulfinylmethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 126545840 |
| Molecular Formula | C15H21BrFNOS |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (1S)-1-(3-bromo-5-fluorophenyl)-N-(tert-butylsulfinylmethyl)but-3-en-1-amine |
| SMILES | C=CC[C@H](NCS(=O)C(C)(C)C)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C15H21BrFNOS/c1-5-6-14(18-10-20(19)15(2,3)4)11-7-12(16)9-13(17)8-11/h5,7-9,14,18H,1,6,10H2,2-4H3/t14-,20?/m0/s1 |
| InChIKey | HOLABZJVQPURMG-PVCZSOGJSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|