C12H16BrFN2O3S — CID 118045788
N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-nitroethyl]-2-methylpropane-2-sulfinamide (PubChem CID 118045788) has the molecular formula C12H16BrFN2O3S and a molecular weight of 367.24 g/mol. Its IUPAC name is N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-nitroethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-nitroethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118045788 |
| Molecular Formula | C12H16BrFN2O3S |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-nitroethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@H](C[N+](=O)[O-])c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C12H16BrFN2O3S/c1-12(2,3)20(19)15-11(7-16(17)18)8-4-9(13)6-10(14)5-8/h4-6,11,15H,7H2,1-3H3/t11-,20?/m1/s1 |
| InChIKey | WGGMMFAEMZMFKV-UAPALYRASA-N |
| XLogP | 2.96 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|