C11H15F3N2O — CID 105323768
[2-propan-2-yloxy-1-(2,4,6-trifluorophenyl)ethyl]hydrazine (PubChem CID 105323768) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is [2-propan-2-yloxy-1-(2,4,6-trifluorophenyl)ethyl]hydrazine.
| Compound Name | [2-propan-2-yloxy-1-(2,4,6-trifluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105323768 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [2-propan-2-yloxy-1-(2,4,6-trifluorophenyl)ethyl]hydrazine |
| SMILES | CC(C)OCC(NN)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H15F3N2O/c1-6(2)17-5-10(16-15)11-8(13)3-7(12)4-9(11)14/h3-4,6,10,16H,5,15H2,1-2H3 |
| InChIKey | BTLAFDPRAQDQSG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|