C8H8Br2N2S — CID 107970024
1-(2,5-dibromothiophen-3-yl)but-3-ynylhydrazine (PubChem CID 107970024) has the molecular formula C8H8Br2N2S and a molecular weight of 324.04 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)but-3-ynylhydrazine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)but-3-ynylhydrazine |
|---|---|
| PubChem CID | 107970024 |
| Molecular Formula | C8H8Br2N2S |
| Molecular Weight | 324.04 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)but-3-ynylhydrazine |
| SMILES | C#CCC(NN)c1cc(Br)sc1Br |
| InChI | InChI=1S/C8H8Br2N2S/c1-2-3-6(12-11)5-4-7(9)13-8(5)10/h1,4,6,12H,3,11H2 |
| InChIKey | SXUZMOPPFSSYTQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.04 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|