C9H14Br2N2OS — CID 107970665
[1-(2,5-dibromothiophen-3-yl)-4-methoxybutyl]hydrazine (PubChem CID 107970665) has the molecular formula C9H14Br2N2OS and a molecular weight of 358.10 g/mol. Its IUPAC name is [1-(2,5-dibromothiophen-3-yl)-4-methoxybutyl]hydrazine.
| Compound Name | [1-(2,5-dibromothiophen-3-yl)-4-methoxybutyl]hydrazine |
|---|---|
| PubChem CID | 107970665 |
| Molecular Formula | C9H14Br2N2OS |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | [1-(2,5-dibromothiophen-3-yl)-4-methoxybutyl]hydrazine |
| SMILES | COCCCC(NN)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H14Br2N2OS/c1-14-4-2-3-7(13-12)6-5-8(10)15-9(6)11/h5,7,13H,2-4,12H2,1H3 |
| InChIKey | NVCHCUPLRKHEGU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|