C13H13Br2FN2S — CID 114022387
[1-(2,5-dibromothiophen-3-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine (PubChem CID 114022387) has the molecular formula C13H13Br2FN2S and a molecular weight of 408.13 g/mol. Its IUPAC name is [1-(2,5-dibromothiophen-3-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dibromothiophen-3-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 114022387 |
| Molecular Formula | C13H13Br2FN2S |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | [1-(2,5-dibromothiophen-3-yl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(F)ccc1CC(NN)c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H13Br2FN2S/c1-7-4-9(16)3-2-8(7)5-11(18-17)10-6-12(14)19-13(10)15/h2-4,6,11,18H,5,17H2,1H3 |
| InChIKey | ASMWOHNYODTJBG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|