C10H15Br2NOS — CID 107969328
1-(2,5-dibromothiophen-3-yl)-4-methoxy-N-methylbutan-1-amine (PubChem CID 107969328) has the molecular formula C10H15Br2NOS and a molecular weight of 357.11 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-4-methoxy-N-methylbutan-1-amine.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-4-methoxy-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 107969328 |
| Molecular Formula | C10H15Br2NOS |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-4-methoxy-N-methylbutan-1-amine |
| SMILES | CNC(CCCOC)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H15Br2NOS/c1-13-8(4-3-5-14-2)7-6-9(11)15-10(7)12/h6,8,13H,3-5H2,1-2H3 |
| InChIKey | IBHILKCKXMQQCV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|