C10H12Br2N4S — CID 107970127
[1-(2,5-dibromothiophen-3-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine (PubChem CID 107970127) has the molecular formula C10H12Br2N4S and a molecular weight of 380.11 g/mol. Its IUPAC name is [1-(2,5-dibromothiophen-3-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dibromothiophen-3-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107970127 |
| Molecular Formula | C10H12Br2N4S |
| Molecular Weight | 380.11 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | [1-(2,5-dibromothiophen-3-yl)-2-(1-methylpyrazol-4-yl)ethyl]hydrazine |
| SMILES | Cn1cc(CC(NN)c2cc(Br)sc2Br)cn1 |
| InChI | InChI=1S/C10H12Br2N4S/c1-16-5-6(4-14-16)2-8(15-13)7-3-9(11)17-10(7)12/h3-5,8,15H,2,13H2,1H3 |
| InChIKey | MPDGGLMOLMKPQZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|