C10H8F3N — CID 104995664
N-methyl-1-(2,4,6-trifluorophenyl)prop-2-yn-1-amine (PubChem CID 104995664) has the molecular formula C10H8F3N and a molecular weight of 199.17 g/mol. Its IUPAC name is N-methyl-1-(2,4,6-trifluorophenyl)prop-2-yn-1-amine.
| Compound Name | N-methyl-1-(2,4,6-trifluorophenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 104995664 |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-methyl-1-(2,4,6-trifluorophenyl)prop-2-yn-1-amine |
| SMILES | C#CC(NC)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H8F3N/c1-3-9(14-2)10-7(12)4-6(11)5-8(10)13/h1,4-5,9,14H,2H3 |
| InChIKey | JSUIQTZARZQASZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|