C6H11N5 — CID 105254611
[cyclopropyl(2H-triazol-4-yl)methyl]hydrazine (PubChem CID 105254611) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is [cyclopropyl(2H-triazol-4-yl)methyl]hydrazine.
| Compound Name | [cyclopropyl(2H-triazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105254611 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | [cyclopropyl(2H-triazol-4-yl)methyl]hydrazine |
| SMILES | NNC(c1cn[nH]n1)C1CC1 |
| InChI | InChI=1S/C6H11N5/c7-9-6(4-1-2-4)5-3-8-11-10-5/h3-4,6,9H,1-2,7H2,(H,8,10,11) |
| InChIKey | ABTOGRYCTKYOQX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|