C8H15N5 — CID 105254737
[4-methyl-1-(2H-triazol-4-yl)pent-4-enyl]hydrazine (PubChem CID 105254737) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is [4-methyl-1-(2H-triazol-4-yl)pent-4-enyl]hydrazine.
| Compound Name | [4-methyl-1-(2H-triazol-4-yl)pent-4-enyl]hydrazine |
|---|---|
| PubChem CID | 105254737 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | [4-methyl-1-(2H-triazol-4-yl)pent-4-enyl]hydrazine |
| SMILES | C=C(C)CCC(NN)c1cn[nH]n1 |
| InChI | InChI=1S/C8H15N5/c1-6(2)3-4-7(11-9)8-5-10-13-12-8/h5,7,11H,1,3-4,9H2,2H3,(H,10,12,13) |
| InChIKey | YVRWRGUVWVIXLR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|