C8H14N4 — CID 114475564
4-methyl-1-(2H-triazol-4-yl)pent-4-en-1-amine (PubChem CID 114475564) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 4-methyl-1-(2H-triazol-4-yl)pent-4-en-1-amine.
| Compound Name | 4-methyl-1-(2H-triazol-4-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 114475564 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 4-methyl-1-(2H-triazol-4-yl)pent-4-en-1-amine |
| SMILES | C=C(C)CCC(N)c1cn[nH]n1 |
| InChI | InChI=1S/C8H14N4/c1-6(2)3-4-7(9)8-5-10-12-11-8/h5,7H,1,3-4,9H2,2H3,(H,10,11,12) |
| InChIKey | VIVWZJVNNMFBIH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|