C13H20N2 — CID 114475839
1-(3,5-dimethyl-2-pyridinyl)-4-methylpent-4-en-1-amine (PubChem CID 114475839) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-pyridinyl)-4-methylpent-4-en-1-amine.
| Compound Name | 1-(3,5-dimethyl-2-pyridinyl)-4-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 114475839 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-(3,5-dimethyl-2-pyridinyl)-4-methylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(N)c1ncc(C)cc1C |
| InChI | InChI=1S/C13H20N2/c1-9(2)5-6-12(14)13-11(4)7-10(3)8-15-13/h7-8,12H,1,5-6,14H2,2-4H3 |
| InChIKey | DQJJWMHIGXVFLB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|