C9H13NO2 — CID 169267261
1-(3,5-dimethyl-2-pyridinyl)ethane-1,2-diol (PubChem CID 169267261) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-pyridinyl)ethane-1,2-diol.
| Compound Name | 1-(3,5-dimethyl-2-pyridinyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 169267261 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-(3,5-dimethyl-2-pyridinyl)ethane-1,2-diol |
| SMILES | Cc1cnc(C(O)CO)c(C)c1 |
| InChI | InChI=1S/C9H13NO2/c1-6-3-7(2)9(10-4-6)8(12)5-11/h3-4,8,11-12H,5H2,1-2H3 |
| InChIKey | QSCLKZXODYHLAZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |