C12H14N2S — CID 78923574
(4-ethylphenyl)-(1,3-thiazol-4-yl)methanamine (PubChem CID 78923574) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is (4-ethylphenyl)-(1,3-thiazol-4-yl)methanamine.
| Compound Name | (4-ethylphenyl)-(1,3-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 78923574 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (4-ethylphenyl)-(1,3-thiazol-4-yl)methanamine |
| SMILES | CCc1ccc(C(N)c2cscn2)cc1 |
| InChI | InChI=1S/C12H14N2S/c1-2-9-3-5-10(6-4-9)12(13)11-7-15-8-14-11/h3-8,12H,2,13H2,1H3 |
| InChIKey | DWPQRQIUDQGLOP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |