About 4-butyl-5-iodopyrimidine
4-butyl-5-iodopyrimidine (PubChem CID 166871786) has the molecular formula C8H11IN2
and a molecular weight of 262.09 g/mol. Its IUPAC name is 4-butyl-5-iodopyrimidine.
Molecular Properties
| Compound Name | 4-butyl-5-iodopyrimidine |
| PubChem CID | 166871786 |
| Molecular Formula | C8H11IN2 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 4-butyl-5-iodopyrimidine |
| SMILES | CCCCc1ncncc1I |
| InChI | InChI=1S/C8H11IN2/c1-2-3-4-8-7(9)5-10-6-11-8/h5-6H,2-4H2,1H3 |
| InChIKey | RYUGERMVLJJCPI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-5-iodopyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-iodopyrimidine?
The IUPAC name of 4-butyl-5-iodopyrimidine (CID 166871786) is 4-butyl-5-iodopyrimidine.
What is the SMILES notation for 4-butyl-5-iodopyrimidine?
The canonical SMILES for 4-butyl-5-iodopyrimidine is CCCCc1ncncc1I.
What is the InChIKey of 4-butyl-5-iodopyrimidine?
The InChIKey is RYUGERMVLJJCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IN2/c1-2-3-4-8-7(9)5-10-6-11-8/h5-6H,2-4H2,1H3.
What are the key properties of 4-butyl-5-iodopyrimidine?
4-butyl-5-iodopyrimidine has a molecular weight of 262.09 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-iodopyrimidine is sourced from PubChem (CID 166871786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).