C14H24BrP — CID 175177342
(2,3,4-trimethyl-5-pentylphenyl)phosphane;hydrobromide (PubChem CID 175177342) has the molecular formula C14H24BrP and a molecular weight of 303.22 g/mol. Its IUPAC name is (2,3,4-trimethyl-5-pentylphenyl)phosphane;hydrobromide.
| Compound Name | (2,3,4-trimethyl-5-pentylphenyl)phosphane;hydrobromide |
|---|---|
| PubChem CID | 175177342 |
| Molecular Formula | C14H24BrP |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2,3,4-trimethyl-5-pentylphenyl)phosphane;hydrobromide |
| SMILES | Br.CCCCCc1cc(P)c(C)c(C)c1C |
| InChI | InChI=1S/C14H23P.BrH/c1-5-6-7-8-13-9-14(15)12(4)10(2)11(13)3;/h9H,5-8,15H2,1-4H3;1H |
| InChIKey | SCDADXBQLUGXFD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|