C14H20NO- — CID 18794193
2-(4-tert-butyl-2,6-dimethylphenyl)ethanimidate (PubChem CID 18794193) has the molecular formula C14H20NO- and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,6-dimethylphenyl)ethanimidate.
| Compound Name | 2-(4-tert-butyl-2,6-dimethylphenyl)ethanimidate |
|---|---|
| PubChem CID | 18794193 |
| Molecular Formula | C14H20NO- |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(4-tert-butyl-2,6-dimethylphenyl)ethanimidate |
| SMILES | [H]/N=C(\[O-])Cc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C14H21NO/c1-9-6-11(14(3,4)5)7-10(2)12(9)8-13(15)16/h6-7H,8H2,1-5H3,(H2,15,16)/p-1 |
| InChIKey | LAYONLPJVOPBIW-UHFFFAOYSA-M |
| XLogP | 2.48 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|