C19H26O — CID 104803053
1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one (PubChem CID 104803053) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one.
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one |
|---|---|
| PubChem CID | 104803053 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one |
| SMILES | CC#CCCC(=O)Cc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C19H26O/c1-7-8-9-10-17(20)13-18-14(2)11-16(12-15(18)3)19(4,5)6/h11-12H,9-10,13H2,1-6H3 |
| InChIKey | VUHNMIDVJMEHJB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|