About 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one
1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one (PubChem CID 104803053) has the molecular formula C19H26O
and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one |
| PubChem CID | 104803053 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one |
| SMILES | CC#CCCC(=O)Cc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C19H26O/c1-7-8-9-10-17(20)13-18-14(2)11-16(12-15(18)3)19(4,5)6/h11-12H,9-10,13H2,1-6H3 |
| InChIKey | VUHNMIDVJMEHJB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one?
The IUPAC name of 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one (CID 104803053) is 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one.
What is the SMILES notation for 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one?
The canonical SMILES for 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one is CC#CCCC(=O)Cc1c(C)cc(C(C)(C)C)cc1C.
What is the InChIKey of 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one?
The InChIKey is VUHNMIDVJMEHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O/c1-7-8-9-10-17(20)13-18-14(2)11-16(12-15(18)3)19(4,5)6/h11-12H,9-10,13H2,1-6H3.
What are the key properties of 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one?
1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one has a molecular weight of 270.42 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-2,6-dimethylphenyl)hept-5-yn-2-one is sourced from PubChem (CID 104803053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).