C27H37NO2 — CID 158717021
N,3-bis(4-tert-butyl-2,6-dimethylphenyl)-2-oxopropanamide (PubChem CID 158717021) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is N,3-bis(4-tert-butyl-2,6-dimethylphenyl)-2-oxopropanamide.
| Compound Name | N,3-bis(4-tert-butyl-2,6-dimethylphenyl)-2-oxopropanamide |
|---|---|
| PubChem CID | 158717021 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | N,3-bis(4-tert-butyl-2,6-dimethylphenyl)-2-oxopropanamide |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CC(=O)C(=O)Nc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C27H37NO2/c1-16-11-20(26(5,6)7)12-17(2)22(16)15-23(29)25(30)28-24-18(3)13-21(14-19(24)4)27(8,9)10/h11-14H,15H2,1-10H3,(H,28,30) |
| InChIKey | RDPBWHGRYKCJGZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|