C25H33NO2 — CID 159844631
N,3-bis(5-tert-butyl-2-methylphenyl)-2-oxopropanamide (PubChem CID 159844631) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is N,3-bis(5-tert-butyl-2-methylphenyl)-2-oxopropanamide.
| Compound Name | N,3-bis(5-tert-butyl-2-methylphenyl)-2-oxopropanamide |
|---|---|
| PubChem CID | 159844631 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | N,3-bis(5-tert-butyl-2-methylphenyl)-2-oxopropanamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1CC(=O)C(=O)Nc1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C25H33NO2/c1-16-9-11-19(24(3,4)5)13-18(16)14-22(27)23(28)26-21-15-20(25(6,7)8)12-10-17(21)2/h9-13,15H,14H2,1-8H3,(H,26,28) |
| InChIKey | UDNDAMUDLOBLQN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|