C18H17ClFN3S — CID 71897161
(6-fluoroquinolin-8-yl)methyl N'-(3-methylphenyl)carbamimidothioate;hydrochloride (PubChem CID 71897161) has the molecular formula C18H17ClFN3S and a molecular weight of 361.87 g/mol. Its IUPAC name is (6-fluoroquinolin-8-yl)methyl N'-(3-methylphenyl)carbamimidothioate;hydrochloride.
| Compound Name | (6-fluoroquinolin-8-yl)methyl N'-(3-methylphenyl)carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 71897161 |
| Molecular Formula | C18H17ClFN3S |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (6-fluoroquinolin-8-yl)methyl N'-(3-methylphenyl)carbamimidothioate;hydrochloride |
| SMILES | Cc1cccc(/N=C(\N)SCc2cc(F)cc3cccnc23)c1.Cl |
| InChI | InChI=1S/C18H16FN3S.ClH/c1-12-4-2-6-16(8-12)22-18(20)23-11-14-10-15(19)9-13-5-3-7-21-17(13)14;/h2-10H,11H2,1H3,(H2,20,22);1H |
| InChIKey | HRMRUUOXTBRDRK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|